C21H33N3O7 — CID 90678021
[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hexanoyloxy-4-hydroxyoxolan-2-yl]methyl hexanoate (PubChem CID 90678021) has the molecular formula C21H33N3O7 and a molecular weight of 439.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hexanoyloxy-4-hydroxyoxolan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hexanoyloxy-4-hydroxyoxolan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 90678021 |
| Molecular Formula | C21H33N3O7 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hexanoyloxy-4-hydroxyoxolan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](O)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C21H33N3O7/c1-3-5-7-9-16(25)29-13-14-19(31-17(26)10-8-6-4-2)18(27)20(30-14)24-12-11-15(22)23-21(24)28/h11-12,14,18-20,27H,3-10,13H2,1-2H3,(H2,22,23,28)/t14-,18+,19-,20-/m1/s1 |
| InChIKey | DANVOSMYVYHLFJ-ZVEHZALQSA-N |
| XLogP | 1.70 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|