C17H25N3O6 — CID 143836525
[4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pentanoate (PubChem CID 143836525) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is [4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pentanoate.
| Compound Name | [4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pentanoate |
|---|---|
| PubChem CID | 143836525 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCC1OC(n2ccc(N)nc2=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C17H25N3O6/c1-4-5-6-12(21)23-9-10-13-14(26-17(2,3)25-13)15(24-10)20-8-7-11(18)19-16(20)22/h7-8,10,13-15H,4-6,9H2,1-3H3,(H2,18,19,22) |
| InChIKey | RCNWFNZHCCJHPP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |