C12H18N3O8P — CID 134867420
[(4R,6R)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 134867420) has the molecular formula C12H18N3O8P and a molecular weight of 363.26 g/mol. Its IUPAC name is [(4R,6R)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(4R,6R)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 134867420 |
| Molecular Formula | C12H18N3O8P |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(4R,6R)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CC1(C)OC2C(O1)[C@@H](COP(=O)(O)O)O[C@H]2n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H18N3O8P/c1-12(2)22-8-6(5-20-24(17,18)19)21-10(9(8)23-12)15-4-3-7(13)14-11(15)16/h3-4,6,8-10H,5H2,1-2H3,(H2,13,14,16)(H2,17,18,19)/t6-,8?,9?,10-/m1/s1 |
| InChIKey | FYCDYIZYNMYTPV-UHMNONSZSA-N |
| XLogP | -0.65 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|