C9H14N3NaO8P — CID 66820829
D-Cytidine 5'-monophosphate disodium salt (PubChem CID 66820829) has the molecular formula C9H14N3NaO8P and a molecular weight of 346.19 g/mol.
| Compound Name | D-Cytidine 5'-monophosphate disodium salt |
|---|---|
| PubChem CID | 66820829 |
| Molecular Formula | C9H14N3NaO8P |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | — |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1.[Na] |
| InChI | InChI=1S/C9H14N3O8P.Na/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18);/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | ZRWPTARDKZMNQK-IAIGYFSYSA-N |
| XLogP | -2.83 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|