C9H13FN3O7P — CID 87861929
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-fluorophosphinic acid (PubChem CID 87861929) has the molecular formula C9H13FN3O7P and a molecular weight of 325.19 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-fluorophosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-fluorophosphinic acid |
|---|---|
| PubChem CID | 87861929 |
| Molecular Formula | C9H13FN3O7P |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-fluorophosphinic acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)F)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13FN3O7P/c10-21(17,18)19-3-4-6(14)7(15)8(20-4)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H,17,18)(H2,11,12,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | XTRNEDGOUHCGJB-XVFCMESISA-N |
| XLogP | -1.47 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|