C24H33N4O9P — CID 122551556
propan-2-yl (2S)-2-[[[(3aR,4R,6R,6aR)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122551556) has the molecular formula C24H33N4O9P and a molecular weight of 552.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3aR,4R,6R,6aR)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3aR,4R,6R,6aR)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122551556 |
| Molecular Formula | C24H33N4O9P |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3aR,4R,6R,6aR)-4-(4-amino-2-oxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H]2OC(C)(C)O[C@@H]21)Oc1ccccc1 |
| InChI | InChI=1S/C24H33N4O9P/c1-14(2)33-22(29)15(3)27-38(31,37-16-9-7-6-8-10-16)32-13-17-19-20(36-24(4,5)35-19)21(34-17)28-12-11-18(25)26-23(28)30/h6-12,14-15,17,19-21H,13H2,1-5H3,(H,27,31)(H2,25,26,30)/t15-,17+,19+,20+,21+,38?/m0/s1 |
| InChIKey | KIHUSWUAPVUOOZ-SGTHQLBNSA-N |
| XLogP | 2.38 |
| TPSA | 162.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|