C24H31N4O8P — CID 77146976
propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 77146976) has the molecular formula C24H31N4O8P and a molecular weight of 534.51 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 77146976 |
| Molecular Formula | C24H31N4O8P |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#CC1(C)C(O)C(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)OC1n1ccc(N)nc1=O |
| InChI | InChI=1S/C24H31N4O8P/c1-6-24(5)20(29)18(35-22(24)28-13-12-19(25)26-23(28)31)14-33-37(32,36-17-10-8-7-9-11-17)27-16(4)21(30)34-15(2)3/h1,7-13,15-16,18,20,22,29H,14H2,2-5H3,(H,27,32)(H2,25,26,31) |
| InChIKey | GRYNZOVDNGJQQD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|