C22H29FIN4O8P — CID 122579810
1-iodopropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122579810) has the molecular formula C22H29FIN4O8P and a molecular weight of 654.37 g/mol. Its IUPAC name is 1-iodopropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 1-iodopropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122579810 |
| Molecular Formula | C22H29FIN4O8P |
| Molecular Weight | 654.37 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 1-iodopropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(I)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29FIN4O8P/c1-4-16(24)35-19(30)13(2)27-37(32,36-14-8-6-5-7-9-14)33-12-15-18(29)22(3,23)20(34-15)28-11-10-17(25)26-21(28)31/h5-11,13,15-16,18,20,29H,4,12H2,1-3H3,(H,27,32)(H2,25,26,31)/t13-,15+,16?,18+,20+,22+,37?/m0/s1 |
| InChIKey | CVBHDWZPTIBHOO-FUOVNFHKSA-N |
| XLogP | 2.71 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|