C25H33FN3O11P — CID 155540689
ethyl 3-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate (PubChem CID 155540689) has the molecular formula C25H33FN3O11P and a molecular weight of 601.52 g/mol. Its IUPAC name is ethyl 3-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate.
| Compound Name | ethyl 3-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 155540689 |
| Molecular Formula | C25H33FN3O11P |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | ethyl 3-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate |
| SMILES | CCOC(=O)n1c(=O)ccn([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@@]2(C)F)c1=O |
| InChI | InChI=1S/C25H33FN3O11P/c1-6-36-24(34)29-19(30)12-13-28(23(29)33)22-25(5,26)20(31)18(39-22)14-37-41(35,40-17-10-8-7-9-11-17)27-16(4)21(32)38-15(2)3/h7-13,15-16,18,20,22,31H,6,14H2,1-5H3,(H,27,35)/t16-,18+,20+,22+,25+,41-/m0/s1 |
| InChIKey | ZWKFPWBVHIHBOE-AHXYRNBVSA-N |
| XLogP | 2.13 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|