C27H37FN3O12P — CID 155553561
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(1-ethoxycarbonyloxyethyl)-2,4-dioxopyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155553561) has the molecular formula C27H37FN3O12P and a molecular weight of 645.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(1-ethoxycarbonyloxyethyl)-2,4-dioxopyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(1-ethoxycarbonyloxyethyl)-2,4-dioxopyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155553561 |
| Molecular Formula | C27H37FN3O12P |
| Molecular Weight | 645.57 g/mol |
| Exact Mass | 645.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(1-ethoxycarbonyloxyethyl)-2,4-dioxopyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)OC(C)n1c(=O)ccn([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@@]2(C)F)c1=O |
| InChI | InChI=1S/C27H37FN3O12P/c1-7-38-26(36)41-18(5)31-21(32)13-14-30(25(31)35)24-27(6,28)22(33)20(42-24)15-39-44(37,43-19-11-9-8-10-12-19)29-17(4)23(34)40-16(2)3/h8-14,16-18,20,22,24,33H,7,15H2,1-6H3,(H,29,37)/t17-,18?,20+,22+,24+,27+,44-/m0/s1 |
| InChIKey | YVPQSXVUELVVIR-DMVCZQHMSA-N |
| XLogP | 2.82 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|