C22H27FN3O11P — CID 134218948
(2S)-2-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxypropanoic acid (PubChem CID 134218948) has the molecular formula C22H27FN3O11P and a molecular weight of 559.44 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxypropanoic acid.
| Compound Name | (2S)-2-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 134218948 |
| Molecular Formula | C22H27FN3O11P |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | (2S)-2-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxypropanoic acid |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1)C(=O)O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C22H27FN3O11P/c1-12(19(31)35-13(2)18(29)30)25-38(33,37-14-7-5-4-6-8-14)34-11-15-17(28)22(3,23)20(36-15)26-10-9-16(27)24-21(26)32/h4-10,12-13,15,17,20,28H,11H2,1-3H3,(H,25,33)(H,29,30)(H,24,27,32)/t12-,13-,15+,17+,20+,22+,38?/m0/s1 |
| InChIKey | WFCIKEHAHKKRPJ-UTFQJDIZSA-N |
| XLogP | 0.72 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|