C20H25FN3O8PS — CID 118221365
S-methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanethioate (PubChem CID 118221365) has the molecular formula C20H25FN3O8PS and a molecular weight of 517.47 g/mol. Its IUPAC name is S-methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanethioate.
| Compound Name | S-methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanethioate |
|---|---|
| PubChem CID | 118221365 |
| Molecular Formula | C20H25FN3O8PS |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | S-methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanethioate |
| SMILES | CSC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H25FN3O8PS/c1-12(17(27)34-3)23-33(29,32-13-7-5-4-6-8-13)30-11-14-16(26)20(2,21)18(31-14)24-10-9-15(25)22-19(24)28/h4-10,12,14,16,18,26H,11H2,1-3H3,(H,23,29)(H,22,25,28)/t12-,14+,16+,18+,20+,33?/m0/s1 |
| InChIKey | TYKWSIZQBGWZLI-DISMYMGNSA-N |
| XLogP | 1.59 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|