C19H22F2N3O9P — CID 123196999
(2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoic acid (PubChem CID 123196999) has the molecular formula C19H22F2N3O9P and a molecular weight of 505.37 g/mol. Its IUPAC name is (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoic acid.
| Compound Name | (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 123196999 |
| Molecular Formula | C19H22F2N3O9P |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoic acid |
| SMILES | C[C@@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C19H22F2N3O9P/c1-10(16(27)28)23-34(30,33-12-5-3-11(20)4-6-12)31-9-13-15(26)19(2,21)17(32-13)24-8-7-14(25)22-18(24)29/h3-8,10,13,15,17,26H,9H2,1-2H3,(H,23,30)(H,27,28)(H,22,25,29)/t10-,13-,15-,17-,19-,34?/m1/s1 |
| InChIKey | HOOMYVPKBHHSFB-FJOQMNSRSA-N |
| XLogP | 0.93 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|