C18H20BrClN3O9P — CID 126618152
(2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 126618152) has the molecular formula C18H20BrClN3O9P and a molecular weight of 568.70 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 126618152 |
| Molecular Formula | C18H20BrClN3O9P |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](Cl)(Br)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20BrClN3O9P/c1-10(15(26)27)22-33(29,32-11-5-3-2-4-6-11)30-9-12-14(25)18(19,20)16(31-12)23-8-7-13(24)21-17(23)28/h2-8,10,12,14,16,25H,9H2,1H3,(H,22,29)(H,26,27)(H,21,24,28)/t10-,12+,14+,16+,18-,33-/m0/s1 |
| InChIKey | SLFMWMGITKIDLU-HGMYNADESA-N |
| XLogP | 1.39 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|