C22H28BrClN3O10P — CID 126618140
ethyl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxybutanoate (PubChem CID 126618140) has the molecular formula C22H28BrClN3O10P and a molecular weight of 640.81 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxybutanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxybutanoate |
|---|---|
| PubChem CID | 126618140 |
| Molecular Formula | C22H28BrClN3O10P |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxybutanoate |
| SMILES | CCOC(=O)[C@@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](Cl)(Br)[C@@H]1O)Oc1ccccc1)C(C)OC |
| InChI | InChI=1S/C22H28BrClN3O10P/c1-4-34-19(30)17(13(2)33-3)26-38(32,37-14-8-6-5-7-9-14)35-12-15-18(29)22(23,24)20(36-15)27-11-10-16(28)25-21(27)31/h5-11,13,15,17-18,20,29H,4,12H2,1-3H3,(H,26,32)(H,25,28,31)/t13?,15-,17+,18-,20-,22+,38?/m1/s1 |
| InChIKey | UNYTXBZRLGESML-JJIOITQASA-N |
| XLogP | 1.88 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|