C27H37FN3O11P — CID 138550774
7-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxyoctanoic acid (PubChem CID 138550774) has the molecular formula C27H37FN3O11P and a molecular weight of 629.58 g/mol. Its IUPAC name is 7-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxyoctanoic acid.
| Compound Name | 7-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxyoctanoic acid |
|---|---|
| PubChem CID | 138550774 |
| Molecular Formula | C27H37FN3O11P |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | 7-[(2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoyl]oxyoctanoic acid |
| SMILES | CC(CCCCCC(=O)O)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H37FN3O11P/c1-17(10-6-4-9-13-22(33)34)40-24(36)18(2)30-43(38,42-19-11-7-5-8-12-19)39-16-20-23(35)27(3,28)25(41-20)31-15-14-21(32)29-26(31)37/h5,7-8,11-12,14-15,17-18,20,23,25,35H,4,6,9-10,13,16H2,1-3H3,(H,30,38)(H,33,34)(H,29,32,37)/t17?,18-,20+,23+,25+,27+,43?/m0/s1 |
| InChIKey | PKADZZVGPXEEIP-SUIYIZGMSA-N |
| XLogP | 2.67 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|