C23H29N4O9P — CID 126512662
propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126512662) has the molecular formula C23H29N4O9P and a molecular weight of 536.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126512662 |
| Molecular Formula | C23H29N4O9P |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)C(COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C23H29N4O9P/c1-5-23(31)19(28)17(35-21(23)27-12-11-18(24)25-22(27)30)13-33-37(32,36-16-9-7-6-8-10-16)26-15(4)20(29)34-14(2)3/h1,6-12,14-15,17,19,21,28,31H,13H2,2-4H3,(H,26,32)(H2,24,25,30)/t15-,17?,19+,21+,23+,37?/m0/s1 |
| InChIKey | AJYYQCRGUHWLNM-CKFGRMDSSA-N |
| XLogP | 0.58 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|