C24H30N3O10P — CID 90059689
[(2S)-butan-2-yl] (2S)-2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90059689) has the molecular formula C24H30N3O10P and a molecular weight of 551.49 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (2S)-2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [(2S)-butan-2-yl] (2S)-2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90059689 |
| Molecular Formula | C24H30N3O10P |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [(2S)-butan-2-yl] (2S)-2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(O)C(n2ccc(=O)[nH]c2=O)O[C@H](COP(=O)(N[C@@H](C)C(=O)O[C@@H](C)CC)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C24H30N3O10P/c1-5-15(3)35-21(30)16(4)26-38(33,37-17-10-8-7-9-11-17)34-14-18-20(29)24(32,6-2)22(36-18)27-13-12-19(28)25-23(27)31/h2,7-13,15-16,18,20,22,29,32H,5,14H2,1,3-4H3,(H,26,33)(H,25,28,31)/t15-,16-,18+,20+,22?,24+,38?/m0/s1 |
| InChIKey | DCDKKGGYYNJJKA-BYIPSSDTSA-N |
| XLogP | 0.68 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|