C25H31ClN3O10P — CID 90044633
pentan-3-yl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 90044633) has the molecular formula C25H31ClN3O10P and a molecular weight of 599.96 g/mol. Its IUPAC name is pentan-3-yl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | pentan-3-yl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90044633 |
| Molecular Formula | C25H31ClN3O10P |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | pentan-3-yl (2S)-2-[[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OC(CC)CC)Oc2ccc(Cl)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C25H31ClN3O10P/c1-5-17(6-2)37-22(32)15(4)28-40(35,39-18-10-8-16(26)9-11-18)36-14-19-21(31)25(34,7-3)23(38-19)29-13-12-20(30)27-24(29)33/h3,8-13,15,17,19,21,23,31,34H,5-6,14H2,1-2,4H3,(H,28,35)(H,27,30,33)/t15-,19+,21+,23+,25+,40?/m0/s1 |
| InChIKey | ZXARRVSSAGMRLE-WQZFGADUSA-N |
| XLogP | 1.73 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|