C27H32ClN2O10P — CID 147034766
cyclohexyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate (PubChem CID 147034766) has the molecular formula C27H32ClN2O10P and a molecular weight of 610.98 g/mol. Its IUPAC name is cyclohexyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate.
| Compound Name | cyclohexyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 147034766 |
| Molecular Formula | C27H32ClN2O10P |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | cyclohexyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(C[C@@H](C)C(=O)OC2CCCCC2)Oc2ccc(Cl)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C27H32ClN2O10P/c1-3-27(35)23(32)21(39-25(27)30-14-13-22(31)29-26(30)34)15-37-41(36,40-20-11-9-18(28)10-12-20)16-17(2)24(33)38-19-7-5-4-6-8-19/h1,9-14,17,19,21,23,25,32,35H,4-8,15-16H2,2H3,(H,29,31,34)/t17-,21-,23-,25-,27-,41?/m1/s1 |
| InChIKey | AYGZCJHHNKWFFY-NCTHMWKISA-N |
| XLogP | 2.61 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|