C25H34ClN2O9PS — CID 159104627
2,2-dimethylpropyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate (PubChem CID 159104627) has the molecular formula C25H34ClN2O9PS and a molecular weight of 605.05 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 159104627 |
| Molecular Formula | C25H34ClN2O9PS |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-3-[(4-chlorophenoxy)-[[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
| SMILES | C[C@H](CP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=S)C(C)(O)[C@H]1O)Oc1ccc(Cl)cc1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C25H34ClN2O9PS/c1-15(21(31)34-14-24(2,3)4)13-38(33,37-17-8-6-16(26)7-9-17)35-12-18-20(30)25(5,32)22(36-18)28-11-10-19(29)27-23(28)39/h6-11,15,18,20,22,30,32H,12-14H2,1-5H3,(H,27,29,39)/t15-,18-,20+,22-,25?,38?/m1/s1 |
| InChIKey | AAPPTVHLHZUCMW-MIUCQXGVSA-N |
| XLogP | 4.08 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|