C24H30N3O10P — CID 123476352
2-methylpropyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123476352) has the molecular formula C24H30N3O10P and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-methylpropyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-methylpropyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123476352 |
| Molecular Formula | C24H30N3O10P |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-methylpropyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#CC1(O)C(O)C(COP(=O)(NC(C)C(=O)OCC(C)C)Oc2ccccc2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C24H30N3O10P/c1-5-24(32)20(29)18(36-22(24)27-12-11-19(28)25-23(27)31)14-35-38(33,37-17-9-7-6-8-10-17)26-16(4)21(30)34-13-15(2)3/h1,6-12,15-16,18,20,22,29,32H,13-14H2,2-4H3,(H,26,33)(H,25,28,31) |
| InChIKey | JYTHACTZQXMJBQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|