C23H28N3O9PS — CID 126512660
propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 126512660) has the molecular formula C23H28N3O9PS and a molecular weight of 553.53 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 126512660 |
| Molecular Formula | C23H28N3O9PS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)C(COP(=S)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H28N3O9PS/c1-5-23(31)19(28)17(34-21(23)26-12-11-18(27)24-22(26)30)13-32-36(37,35-16-9-7-6-8-10-16)25-15(4)20(29)33-14(2)3/h1,6-12,14-15,17,19,21,28,31H,13H2,2-4H3,(H,25,37)(H,24,27,30)/t15-,17?,19+,21+,23+,36?/m0/s1 |
| InChIKey | OKHDTYLHZIYMKK-RQMXAGQBSA-N |
| XLogP | 0.41 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|