C24H30N3O9PS — CID 118016805
propan-2-yl 2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118016805) has the molecular formula C24H30N3O9PS and a molecular weight of 567.56 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118016805 |
| Molecular Formula | C24H30N3O9PS |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-prop-1-ynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC#C[C@]1(O)C(n2ccc(=O)[nH]c2=O)O[C@H](COP(=S)(NC(C)C(=O)OC(C)C)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C24H30N3O9PS/c1-5-12-24(32)20(29)18(35-22(24)27-13-11-19(28)25-23(27)31)14-33-37(38,36-17-9-7-6-8-10-17)26-16(4)21(30)34-15(2)3/h6-11,13,15-16,18,20,22,29,32H,14H2,1-4H3,(H,26,38)(H,25,28,31)/t16?,18-,20-,22?,24-,37?/m1/s1 |
| InChIKey | BCGLREZPIBHZRA-SJRDWKCTSA-N |
| XLogP | 0.80 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|