C28H34N3O9PS — CID 66804818
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-phenylpropanoate (PubChem CID 66804818) has the molecular formula C28H34N3O9PS and a molecular weight of 619.63 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 66804818 |
| Molecular Formula | C28H34N3O9PS |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](Cc1ccccc1)NP(=S)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H34N3O9PS/c1-18(2)38-25(34)21(16-19-10-6-4-7-11-19)30-41(42,40-20-12-8-5-9-13-20)37-17-22-24(33)28(3,36)26(39-22)31-15-14-23(32)29-27(31)35/h4-15,18,21-22,24,26,33,36H,16-17H2,1-3H3,(H,30,42)(H,29,32,35)/t21-,22+,24+,26+,28+,41?/m0/s1 |
| InChIKey | OMGDLZVDNGWCDF-IQAJQSBKSA-N |
| XLogP | 2.02 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|