C24H28N3O9PS — CID 56949229
methyl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate (PubChem CID 56949229) has the molecular formula C24H28N3O9PS and a molecular weight of 565.54 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | methyl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 56949229 |
| Molecular Formula | C24H28N3O9PS |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | methyl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=S)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C24H28N3O9PS/c1-14(21(30)33-3)26-37(38,36-17-10-6-8-15-7-4-5-9-16(15)17)34-13-18-20(29)24(2,32)22(35-18)27-12-11-19(28)25-23(27)31/h4-12,14,18,20,22,29,32H,13H2,1-3H3,(H,26,38)(H,25,28,31)/t14?,18-,20-,22-,24-,37?/m1/s1 |
| InChIKey | RYFIMAQYUHJBBN-SMGDBNIFSA-N |
| XLogP | 1.17 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|