C25H25ClN3O10P — CID 89470886
methyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 89470886) has the molecular formula C25H25ClN3O10P and a molecular weight of 593.91 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 89470886 |
| Molecular Formula | C25H25ClN3O10P |
| Molecular Weight | 593.91 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](O)(C#CCl)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C25H25ClN3O10P/c1-15(22(32)36-2)28-40(35,39-18-9-5-7-16-6-3-4-8-17(16)18)37-14-19-21(31)25(34,11-12-26)23(38-19)29-13-10-20(30)27-24(29)33/h3-10,13,15,19,21,23,31,34H,14H2,1-2H3,(H,28,35)(H,27,30,33)/t15-,19+,21+,23+,25+,40?/m0/s1 |
| InChIKey | RVAQUDILHLTPSH-WQZFGADUSA-N |
| XLogP | 1.23 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.91 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|