C29H33ClN3O10P — CID 89470992
pentyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 89470992) has the molecular formula C29H33ClN3O10P and a molecular weight of 650.02 g/mol. Its IUPAC name is pentyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | pentyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 89470992 |
| Molecular Formula | C29H33ClN3O10P |
| Molecular Weight | 650.02 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | pentyl (2S)-2-[[[(2R,3R,4R,5R)-4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](O)(C#CCl)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C29H33ClN3O10P/c1-3-4-7-17-40-26(36)19(2)32-44(39,43-22-12-8-10-20-9-5-6-11-21(20)22)41-18-23-25(35)29(38,14-15-30)27(42-23)33-16-13-24(34)31-28(33)37/h5-6,8-13,16,19,23,25,27,35,38H,3-4,7,17-18H2,1-2H3,(H,32,39)(H,31,34,37)/t19-,23+,25+,27+,29+,44?/m0/s1 |
| InChIKey | ILJWEGZXOBDBOP-XDNBVYKZSA-N |
| XLogP | 2.79 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.02 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|