C23H30ClFN3O9P — CID 58475080
butyl (2S)-2-[[(2-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 58475080) has the molecular formula C23H30ClFN3O9P and a molecular weight of 577.93 g/mol. Its IUPAC name is butyl (2S)-2-[[(2-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[(2-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58475080 |
| Molecular Formula | C23H30ClFN3O9P |
| Molecular Weight | 577.93 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | butyl (2S)-2-[[(2-chlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1Cl |
| InChI | InChI=1S/C23H30ClFN3O9P/c1-4-5-12-34-20(31)14(2)27-38(33,37-16-9-7-6-8-15(16)24)35-13-17-19(30)23(3,25)21(36-17)28-11-10-18(29)26-22(28)32/h6-11,14,17,19,21,30H,4-5,12-13H2,1-3H3,(H,27,33)(H,26,29,32)/t14-,17+,19+,21+,23+,38?/m0/s1 |
| InChIKey | VRULWXUXCBAZSZ-KLPOSVSPSA-N |
| XLogP | 2.70 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.93 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|