C23H30FN6O9P — CID 90299900
butyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 90299900) has the molecular formula C23H30FN6O9P and a molecular weight of 584.50 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90299900 |
| Molecular Formula | C23H30FN6O9P |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FN6O9P/c1-4-5-12-36-20(33)14(2)27-40(35,39-16-8-6-15(24)7-9-16)37-13-17-19(32)23(3,28-29-25)21(38-17)30-11-10-18(31)26-22(30)34/h6-11,14,17,19,21,32H,4-5,12-13H2,1-3H3,(H,27,35)(H,26,31,34)/t14-,17+,19+,21+,23+,40?/m0/s1 |
| InChIKey | IOUHZASLTARZJT-YEDDDGCPSA-N |
| XLogP | 2.53 |
| TPSA | 206.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|