C25H32FN6O9P — CID 66562108
cyclohexyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 66562108) has the molecular formula C25H32FN6O9P and a molecular weight of 610.54 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66562108 |
| Molecular Formula | C25H32FN6O9P |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccc(F)cc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H32FN6O9P/c1-15(22(35)39-17-6-4-3-5-7-17)29-42(37,41-18-10-8-16(26)9-11-18)38-14-19-21(34)25(2,30-31-27)23(40-19)32-13-12-20(33)28-24(32)36/h8-13,15,17,19,21,23,34H,3-7,14H2,1-2H3,(H,29,37)(H,28,33,36)/t15-,19+,21+,23+,25+,42?/m0/s1 |
| InChIKey | HANWGBMCDXZMFW-IGPXBPSGSA-N |
| XLogP | 3.06 |
| TPSA | 206.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|