C22H29N6O7P — CID 70914785
1-[(3R,4S,5R)-3-azido-5-[[(cyclohexylamino)-phenoxyphosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70914785) has the molecular formula C22H29N6O7P and a molecular weight of 520.48 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3-azido-5-[[(cyclohexylamino)-phenoxyphosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4S,5R)-3-azido-5-[[(cyclohexylamino)-phenoxyphosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70914785 |
| Molecular Formula | C22H29N6O7P |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-[(3R,4S,5R)-3-azido-5-[[(cyclohexylamino)-phenoxyphosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@]1(N=[N+]=[N-])C(n2ccc(=O)[nH]c2=O)O[C@H](COP(=O)(NC2CCCCC2)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C22H29N6O7P/c1-22(26-27-23)19(30)17(34-20(22)28-13-12-18(29)24-21(28)31)14-33-36(32,25-15-8-4-2-5-9-15)35-16-10-6-3-7-11-16/h3,6-7,10-13,15,17,19-20,30H,2,4-5,8-9,14H2,1H3,(H,25,32)(H,24,29,31)/t17-,19-,20?,22-,36?/m1/s1 |
| InChIKey | LQWNVPQNNJHIKP-VBWMDDICSA-N |
| XLogP | 2.99 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|