C20H32N7O10P — CID 70914569
ethyl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 70914569) has the molecular formula C20H32N7O10P and a molecular weight of 561.49 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70914569 |
| Molecular Formula | C20H32N7O10P |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(N[C@H](C)C(=O)OCC)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C20H32N7O10P/c1-6-34-16(30)11(3)23-38(33,24-12(4)17(31)35-7-2)36-10-13-15(29)20(5,25-26-21)18(37-13)27-9-8-14(28)22-19(27)32/h8-9,11-13,15,18,29H,6-7,10H2,1-5H3,(H,22,28,32)(H2,23,24,33)/t11-,12+,13-,15-,18-,20-,38?/m1/s1 |
| InChIKey | ALNRAENXMMNMGA-QNEUODBRSA-N |
| XLogP | 0.07 |
| TPSA | 236.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|