C24H33FN3O10P — CID 25094730
butyl (2S)-2-[[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 25094730) has the molecular formula C24H33FN3O10P and a molecular weight of 573.51 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 25094730 |
| Molecular Formula | C24H33FN3O10P |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(C)(F)[C@@H]1O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H33FN3O10P/c1-5-6-13-35-21(31)15(2)27-39(33,38-17-9-7-16(34-4)8-10-17)36-14-18-20(30)24(3,25)22(37-18)28-12-11-19(29)26-23(28)32/h7-12,15,18,20,22,30H,5-6,13-14H2,1-4H3,(H,27,33)(H,26,29,32)/t15-,18+,20+,22+,24?,39?/m0/s1 |
| InChIKey | ZTAUFJUBTFLORM-CJBWEABUSA-N |
| XLogP | 2.06 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|