C21H25Cl2FN3O9P — CID 67442301
ethyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 67442301) has the molecular formula C21H25Cl2FN3O9P and a molecular weight of 584.32 g/mol. Its IUPAC name is ethyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 67442301 |
| Molecular Formula | C21H25Cl2FN3O9P |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | ethyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2FN3O9P/c1-4-33-18(30)11(2)26-37(32,36-12-5-6-13(22)14(23)9-12)34-10-15-17(29)21(3,24)19(35-15)27-8-7-16(28)25-20(27)31/h5-9,11,15,17,19,29H,4,10H2,1-3H3,(H,26,32)(H,25,28,31)/t11-,15+,17+,19+,21+,37?/m0/s1 |
| InChIKey | QYZFNXGZSQGTEI-WDIQIBNZSA-N |
| XLogP | 2.57 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|