C21H23Cl2N4O9P — CID 66576271
methyl (2S)-2-[[[(2R,3S,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3,4-dichlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 66576271) has the molecular formula C21H23Cl2N4O9P and a molecular weight of 577.31 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3,4-dichlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3,4-dichlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66576271 |
| Molecular Formula | C21H23Cl2N4O9P |
| Molecular Weight | 577.31 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3,4-dichlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(C#N)[C@@H]1O)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2N4O9P/c1-11(18(30)33-3)26-37(32,36-12-4-5-13(22)14(23)8-12)34-9-15-17(29)21(2,10-24)19(35-15)27-7-6-16(28)25-20(27)31/h4-8,11,15,17,19,29H,9H2,1-3H3,(H,26,32)(H,25,28,31)/t11-,15+,17+,19+,21+,37?/m0/s1 |
| InChIKey | BXPNPFVVZJMEDH-WDIQIBNZSA-N |
| XLogP | 1.99 |
| TPSA | 181.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|