C26H27Cl2FN3O9P — CID 25095797
benzyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 25095797) has the molecular formula C26H27Cl2FN3O9P and a molecular weight of 646.39 g/mol. Its IUPAC name is benzyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 25095797 |
| Molecular Formula | C26H27Cl2FN3O9P |
| Molecular Weight | 646.39 g/mol |
| Exact Mass | 645.08 |
| IUPAC Name | benzyl (2S)-2-[[(3,4-dichlorophenoxy)-[[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(C)(F)[C@@H]1O)Oc1ccc(Cl)c(Cl)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27Cl2FN3O9P/c1-15(23(35)38-13-16-6-4-3-5-7-16)31-42(37,41-17-8-9-18(27)19(28)12-17)39-14-20-22(34)26(2,29)24(40-20)32-11-10-21(33)30-25(32)36/h3-12,15,20,22,24,34H,13-14H2,1-2H3,(H,31,37)(H,30,33,36)/t15-,20+,22+,24+,26?,42?/m0/s1 |
| InChIKey | XMLGPIWAYGOAIC-OAEULRBNSA-N |
| XLogP | 3.76 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|