C28H32F2N3O9P — CID 134482554
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3-fluoro-4-phenylphenoxy)phosphoryl]amino]propanoate (PubChem CID 134482554) has the molecular formula C28H32F2N3O9P and a molecular weight of 623.55 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3-fluoro-4-phenylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3-fluoro-4-phenylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134482554 |
| Molecular Formula | C28H32F2N3O9P |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(3-fluoro-4-phenylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C28H32F2N3O9P/c1-16(2)40-25(36)17(3)32-43(38,42-19-10-11-20(21(29)14-19)18-8-6-5-7-9-18)39-15-22-24(35)28(4,30)26(41-22)33-13-12-23(34)31-27(33)37/h5-14,16-17,22,24,26,35H,15H2,1-4H3,(H,32,38)(H,31,34,37)/t17?,22-,24-,26-,28-,43?/m1/s1 |
| InChIKey | WGNZDOYYJPULRW-KJQBKXKCSA-N |
| XLogP | 3.46 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|