C28H31FN3O10P — CID 86566922
propan-2-yl (2S)-2-[[dibenzofuran-3-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 86566922) has the molecular formula C28H31FN3O10P and a molecular weight of 619.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[dibenzofuran-3-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[dibenzofuran-3-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86566922 |
| Molecular Formula | C28H31FN3O10P |
| Molecular Weight | 619.54 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[dibenzofuran-3-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C28H31FN3O10P/c1-15(2)39-25(35)16(3)31-43(37,42-17-9-10-19-18-7-5-6-8-20(18)40-21(19)13-17)38-14-22-24(34)28(4,29)26(41-22)32-12-11-23(33)30-27(32)36/h5-13,15-16,22,24,26,34H,14H2,1-4H3,(H,31,37)(H,30,33,36)/t16-,22+,24+,26+,28+,43?/m0/s1 |
| InChIKey | KBOIRJIZIPSUIU-LYHHCAIHSA-N |
| XLogP | 3.56 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|