C19H29N4O9P — CID 130281351
[(2R,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]phosphonamidic acid (PubChem CID 130281351) has the molecular formula C19H29N4O9P and a molecular weight of 488.43 g/mol. Its IUPAC name is [(2R,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]phosphonamidic acid.
| Compound Name | [(2R,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 130281351 |
| Molecular Formula | C19H29N4O9P |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2R,4R,5R)-4-cyano-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-N-[(2S)-1-(2,2-dimethylpropoxy)-1-oxopropan-2-yl]phosphonamidic acid |
| SMILES | C[C@H](NP(=O)(O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(C#N)C1O)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C19H29N4O9P/c1-11(15(26)30-10-18(2,3)4)22-33(28,29)31-8-12-14(25)19(5,9-20)16(32-12)23-7-6-13(24)21-17(23)27/h6-7,11-12,14,16,25H,8,10H2,1-5H3,(H,21,24,27)(H2,22,28,29)/t11-,12+,14?,16+,19+/m0/s1 |
| InChIKey | MDZKSJFEPARZLP-ADHUVUIZSA-N |
| XLogP | 0.01 |
| TPSA | 192.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|