C18H25FN3O8P — CID 90765999
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-ethynylphosphoryl]amino]propanoate (PubChem CID 90765999) has the molecular formula C18H25FN3O8P and a molecular weight of 461.38 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-ethynylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-ethynylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90765999 |
| Molecular Formula | C18H25FN3O8P |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-ethynylphosphoryl]amino]propanoate |
| SMILES | C#CP(=O)(NC(C)C(=O)OC(C)C)OCC1OC(n2ccc(=O)[nH]c2=O)C(C)(F)C1O |
| InChI | InChI=1S/C18H25FN3O8P/c1-6-31(27,21-11(4)15(25)29-10(2)3)28-9-12-14(24)18(5,19)16(30-12)22-8-7-13(23)20-17(22)26/h1,7-8,10-12,14,16,24H,9H2,2-5H3,(H,21,27)(H,20,23,26) |
| InChIKey | AYUFOKGLAHHZIZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|