C21H31FN3O9P — CID 126481559
propan-2-yl (2S)-2-[[[(3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(2E)-penta-2,4-dien-2-yl]oxyphosphoryl]amino]propanoate (PubChem CID 126481559) has the molecular formula C21H31FN3O9P and a molecular weight of 519.46 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(2E)-penta-2,4-dien-2-yl]oxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(2E)-penta-2,4-dien-2-yl]oxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126481559 |
| Molecular Formula | C21H31FN3O9P |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(2E)-penta-2,4-dien-2-yl]oxyphosphoryl]amino]propanoate |
| SMILES | C=C/C=C(\C)OP(=O)(N[C@@H](C)C(=O)OC(C)C)OCC1OC(n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C21H31FN3O9P/c1-7-8-13(4)34-35(30,24-14(5)18(28)32-12(2)3)31-11-15-17(27)21(6,22)19(33-15)25-10-9-16(26)23-20(25)29/h7-10,12,14-15,17,19,27H,1,11H2,2-6H3,(H,24,30)(H,23,26,29)/b13-8+/t14-,15?,17+,19?,21+,35?/m0/s1 |
| InChIKey | QYQQIJYFRUPCNQ-LTJSAUJUSA-N |
| XLogP | 1.68 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|