C18H30N3O9PS — CID 140909638
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate (PubChem CID 140909638) has the molecular formula C18H30N3O9PS and a molecular weight of 495.49 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 140909638 |
| Molecular Formula | C18H30N3O9PS |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate |
| SMILES | CCS[P@@](=O)(N[C@H](C)C(=O)OC(C)C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C18H30N3O9PS/c1-6-32-31(27,20-11(4)15(24)29-10(2)3)28-9-12-14(23)18(5,26)16(30-12)21-8-7-13(22)19-17(21)25/h7-8,10-12,14,16,23,26H,6,9H2,1-5H3,(H,20,27)(H,19,22,25)/t11-,12-,14-,16-,18-,31-/m1/s1 |
| InChIKey | OWEQDOIGLOGFPS-KRKCPTOISA-N |
| XLogP | 0.35 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|