C21H31N4O11PS — CID 159142984
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2,5-dioxopyrrolidin-3-yl)methylsulfanyl]phosphoryl]amino]propanoate (PubChem CID 159142984) has the molecular formula C21H31N4O11PS and a molecular weight of 578.54 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2,5-dioxopyrrolidin-3-yl)methylsulfanyl]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2,5-dioxopyrrolidin-3-yl)methylsulfanyl]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159142984 |
| Molecular Formula | C21H31N4O11PS |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2,5-dioxopyrrolidin-3-yl)methylsulfanyl]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)SCC1CC(=O)NC1=O |
| InChI | InChI=1S/C21H31N4O11PS/c1-10(2)35-18(30)11(3)24-37(33,38-9-12-7-15(27)22-17(12)29)34-8-13-16(28)21(4,32)19(36-13)25-6-5-14(26)23-20(25)31/h5-6,10-13,16,19,28,32H,7-9H2,1-4H3,(H,24,33)(H,22,27,29)(H,23,26,31)/t11-,12?,13-,16-,19-,21-,37-/m1/s1 |
| InChIKey | VDPLXXXWEXPAHE-MJDRIXGXSA-N |
| XLogP | -1.00 |
| TPSA | 215.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|