C21H34N3O11PS — CID 90381032
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(3-ethoxy-3-oxopropyl)sulfanylphosphoryl]amino]propanoate (PubChem CID 90381032) has the molecular formula C21H34N3O11PS and a molecular weight of 567.55 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(3-ethoxy-3-oxopropyl)sulfanylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(3-ethoxy-3-oxopropyl)sulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90381032 |
| Molecular Formula | C21H34N3O11PS |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(3-ethoxy-3-oxopropyl)sulfanylphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)CCSP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C21H34N3O11PS/c1-6-32-16(26)8-10-37-36(31,23-13(4)18(28)34-12(2)3)33-11-14-17(27)21(5,30)19(35-14)24-9-7-15(25)22-20(24)29/h7,9,12-14,17,19,27,30H,6,8,10-11H2,1-5H3,(H,23,31)(H,22,25,29)/t13-,14+,17+,19+,21+,36?/m0/s1 |
| InChIKey | HJNIBIKEZBOZIM-KIIPBGNNSA-N |
| XLogP | 0.29 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|