C18H26N5O11PS — CID 118639422
methyl (2R)-2-[[[(4R)-2,5-dioxoimidazolidin-4-yl]methylsulfanyl-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 118639422) has the molecular formula C18H26N5O11PS and a molecular weight of 551.47 g/mol. Its IUPAC name is methyl (2R)-2-[[[(4R)-2,5-dioxoimidazolidin-4-yl]methylsulfanyl-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[[(4R)-2,5-dioxoimidazolidin-4-yl]methylsulfanyl-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118639422 |
| Molecular Formula | C18H26N5O11PS |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | methyl (2R)-2-[[[(4R)-2,5-dioxoimidazolidin-4-yl]methylsulfanyl-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)SC[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C18H26N5O11PS/c1-8(14(27)32-3)22-35(31,36-7-9-13(26)21-16(28)19-9)33-6-10-12(25)18(2,30)15(34-10)23-5-4-11(24)20-17(23)29/h4-5,8-10,12,15,25,30H,6-7H2,1-3H3,(H,22,31)(H,20,24,29)(H2,19,21,26,28)/t8-,9+,10-,12-,15-,18-,35-/m1/s1 |
| InChIKey | QYASRCZZATZFHP-ROYJXMHGSA-N |
| XLogP | -2.24 |
| TPSA | 227.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|