C25H33FN3O8P — CID 123797255
cyclohexyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 123797255) has the molecular formula C25H33FN3O8P and a molecular weight of 553.52 g/mol. Its IUPAC name is cyclohexyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123797255 |
| Molecular Formula | C25H33FN3O8P |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | cyclohexyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-(4-fluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1CC(C)C(n2ccc(=O)[nH]c2=O)O1)Oc1ccc(F)cc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H33FN3O8P/c1-16-14-21(35-23(16)29-13-12-22(30)27-25(29)32)15-34-38(33,37-20-10-8-18(26)9-11-20)28-17(2)24(31)36-19-6-4-3-5-7-19/h8-13,16-17,19,21,23H,3-7,14-15H2,1-2H3,(H,28,33)(H,27,30,32) |
| InChIKey | DSTYEWKMOXKCDY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|