C26H30N3O8P — CID 123274202
benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123274202) has the molecular formula C26H30N3O8P and a molecular weight of 543.51 g/mol. Its IUPAC name is benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123274202 |
| Molecular Formula | C26H30N3O8P |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1CC(C)C(n2ccc(=O)[nH]c2=O)O1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H30N3O8P/c1-18-15-22(36-24(18)29-14-13-23(30)27-26(29)32)17-35-38(33,37-21-11-7-4-8-12-21)28-19(2)25(31)34-16-20-9-5-3-6-10-20/h3-14,18-19,22,24H,15-17H2,1-2H3,(H,28,33)(H,27,30,32) |
| InChIKey | MZOKALGNNJJGSM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|