C20H25ClN3O9P — CID 126647627
ethyl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126647627) has the molecular formula C20H25ClN3O9P and a molecular weight of 517.86 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126647627 |
| Molecular Formula | C20H25ClN3O9P |
| Molecular Weight | 517.86 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H25ClN3O9P/c1-3-30-19(27)12(2)23-34(29,33-13-7-5-4-6-8-13)31-11-14-17(26)16(21)18(32-14)24-10-9-15(25)22-20(24)28/h4-10,12,14,16-18,26H,3,11H2,1-2H3,(H,23,29)(H,22,25,28)/t12-,14+,16-,17+,18+,34+/m0/s1 |
| InChIKey | LOVNRHMBQDRNFV-MWHPWAEWSA-N |
| XLogP | 1.15 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|