C23H28N3O9P — CID 123446782
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123446782) has the molecular formula C23H28N3O9P and a molecular weight of 521.46 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123446782 |
| Molecular Formula | C23H28N3O9P |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#CC1C(O)C(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H28N3O9P/c1-5-17-20(28)18(34-21(17)26-12-11-19(27)24-23(26)30)13-32-36(31,35-16-9-7-6-8-10-16)25-15(4)22(29)33-14(2)3/h1,6-12,14-15,17-18,20-21,28H,13H2,2-4H3,(H,25,31)(H,24,27,30) |
| InChIKey | VQNFATWQXGCSJX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|